CAS 1260803-10-8 is the registry number for 6-Bromo-3,4-dihydro-2h-benzo[1,4]oxazine hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
6-bromo-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 1260803-10-8) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 6-bromo-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: PTKDEZMAOAZFJE-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | PTKDEZMAOAZFJE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)