CAS 61858-39-7 appears in our catalog under these names: 2-amino-1-(3-bromophenyl)ethanone hydrochloride, 96%, 2-Amino-1-(3-bromophenyl)ethanone hydrochloride, 2-Amino-3’-bromoacetophenone Hydrochloride, 95%, 95%, 2-Amino-1-(3-bromo-phenyl)-ethanone, hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 10g, 1g, 2,5g.
2-amino-1-(3-bromophenyl)ethanone;hydrochloride (CAS 61858-39-7) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 2-amino-1-(3-bromophenyl)ethanone;hydrochloride. InChIKey: UBJDGVBOZSLUCW-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 2-amino-1-(3-bromophenyl)ethanone;hydrochloride |
| InChIKey | UBJDGVBOZSLUCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CN.Cl |
Computed by PubChem (NCBI)