CAS 2225878-88-4 appears in our catalog under these names: (3S)-6-Bromo-2,3-dihydrobenzo[b]furan-3-ylamine hydrochloride, 95%, (S)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%, 95%, (S)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%, (S)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 10g.
(3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2225878-88-4) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: BTTOLFCXRXFGKD-OGFXRTJISA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | BTTOLFCXRXFGKD-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)