cas: 1259992-37-4 — see every product listed under this CAS number, including other names
2-Amino-3-(4-methyl-3-(trifluoromethyl)phenyl)propanoic acid, 95+% (CAS 1259992-37-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A239025-250mg |
| cas | 1259992-37-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 493.15 Pln | |
| AmBeed | 10g | 7602.07 Pln | |
| AmBeed | 5g | 5108.74 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3-[4-methyl-3-(trifluoromethyl)phenyl]propanoic acid (CAS 1259992-37-4) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: 2-amino-3-[4-methyl-3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: GRXCAPPJSLZHME-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 2-amino-3-[4-methyl-3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | GRXCAPPJSLZHME-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)