Products 131235-51-3
CAS 131235-51-3 is the registry number for 2-Amino-3-(3-trifluoromethyl-phenyl)-propionic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-amino-3-[3-(trifluoromethyl)phenyl]propanoate (CAS 131235-51-3) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: methyl 2-amino-3-[3-(trifluoromethyl)phenyl]propanoate. InChIKey: XDGIKINZWUTOBE-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | methyl 2-amino-3-[3-(trifluoromethyl)phenyl]propanoate |
| InChIKey | XDGIKINZWUTOBE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)