Products 1259992-37-4
CAS 1259992-37-4 appears in our catalog under these names: 4-Methyl-3-(trifluoromethyl)-dl-phenylalanine, 95%, 2-Amino-3-(4-methyl-3-(trifluoromethyl)phenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
2-amino-3-[4-methyl-3-(trifluoromethyl)phenyl]propanoic acid (CAS 1259992-37-4) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: 2-amino-3-[4-methyl-3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: GRXCAPPJSLZHME-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 2-amino-3-[4-methyl-3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | GRXCAPPJSLZHME-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)