CAS 370-56-9 is the registry number for Isopropylm-trifluoromethylcarbanilate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl N-[3-(trifluoromethyl)phenyl]carbamate (CAS 370-56-9) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: propan-2-yl N-[3-(trifluoromethyl)phenyl]carbamate. InChIKey: BXBUGIFDTNEDNS-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | propan-2-yl N-[3-(trifluoromethyl)phenyl]carbamate |
| InChIKey | BXBUGIFDTNEDNS-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)NC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)