Products 1259994-92-7
CAS 1259994-92-7 is the registry number for 2-Methyl-5-(trifluoromethyl)-dl-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-3-[2-methyl-5-(trifluoromethyl)phenyl]propanoic acid (CAS 1259994-92-7) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: 2-amino-3-[2-methyl-5-(trifluoromethyl)phenyl]propanoic acid. InChIKey: UQIIXNIENIPXSV-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 2-amino-3-[2-methyl-5-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | UQIIXNIENIPXSV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)