Products 129941-39-5
CAS 129941-39-5 appears in our catalog under these names: 2-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid methyl ester, 95%, Methyl 2-amino-3-(4-(trifluoromethyl)phenyl)propanoate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-amino-3-[4-(trifluoromethyl)phenyl]propanoate (CAS 129941-39-5) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: methyl 2-amino-3-[4-(trifluoromethyl)phenyl]propanoate. InChIKey: FLZVNAUDBQHCMF-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | methyl 2-amino-3-[4-(trifluoromethyl)phenyl]propanoate |
| InChIKey | FLZVNAUDBQHCMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)