cas: 6388-47-2 — see every product listed under this CAS number, including other names
2-Amino-3-chlorobenzoic Acid, >98.0%(T) (CAS 6388-47-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0786-5G |
| cas | 6388-47-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 226.52 Pln | |
| TCI | 25g | 910.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-amino-3-chlorobenzoic acid (CAS 6388-47-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-amino-3-chlorobenzoic acid. InChIKey: LWUAMROXVQLJKA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-amino-3-chlorobenzoic acid |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)