cas: 6388-47-2 — see every product listed under this CAS number, including other names
2-amino-3-chlorobenzoic acid, 98%, 98% (CAS 6388-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GDE-1kg |
| cas | 6388-47-2 |
| size | 1kg |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 1360.40 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 179.60 Pln | |
| Chemat | 500g | 720.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-chlorobenzoic acid (CAS 6388-47-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-amino-3-chlorobenzoic acid. InChIKey: LWUAMROXVQLJKA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-amino-3-chlorobenzoic acid |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)