cas: 6388-47-2 — see every product listed under this CAS number, including other names
2-Amino-3-chlorobenzoic acid, 95% (CAS 6388-47-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077502-500G |
| cas | 6388-47-2 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500g | 955.93 Pln | |
| Fluorochem | 1kg | 1664.02 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 258.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3-chlorobenzoic acid (CAS 6388-47-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-amino-3-chlorobenzoic acid. InChIKey: LWUAMROXVQLJKA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-amino-3-chlorobenzoic acid |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)