cas: 6388-47-2 — see every product listed under this CAS number, including other names
2-Amino-3-chlorobenzoic acid, 99.94% (CAS 6388-47-2) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 25 g, 10mM/1mL, 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002412-500 g |
| cas | 6388-47-2 |
| size | 500 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 1127.75 Pln | |
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 100 g | 431.15 Pln | |
| MedChemExpress | 50 g | 310.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
2-amino-3-chlorobenzoic acid (CAS 6388-47-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-amino-3-chlorobenzoic acid. InChIKey: LWUAMROXVQLJKA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-amino-3-chlorobenzoic acid |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)