cas: 6388-47-2 — see every product listed under this CAS number, including other names
2-Amino-3-chlorobenzoic acid 98% (CAS 6388-47-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154063-5g |
| cas | 6388-47-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 275.81 Pln | |
| Ambeed | 500g | 1010.06 Pln | |
| Ambeed | 1000g | 1677.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154063 |
2-amino-3-chlorobenzoic acid (CAS 6388-47-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-amino-3-chlorobenzoic acid. InChIKey: LWUAMROXVQLJKA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-amino-3-chlorobenzoic acid |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)