cas: 6388-47-2 — see every product listed under this CAS number, including other names
2-Amino-3-chlorobenzoic acid, 97% (CAS 6388-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 335970010 |
| cas | 6388-47-2 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 113.14 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-amino-3-chlorobenzoic acid (CAS 6388-47-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-amino-3-chlorobenzoic acid. InChIKey: LWUAMROXVQLJKA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-amino-3-chlorobenzoic acid |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)