cas: 36192-63-9 — see every product listed under this CAS number, including other names
2-Amino-4'-methylbenzophenone, 97%, 97% (CAS 36192-63-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY9E-1g |
| cas | 36192-63-9 |
| size | 1g |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1134.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-aminophenyl)-(4-methylphenyl)methanone (CAS 36192-63-9) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: (2-aminophenyl)-(4-methylphenyl)methanone. InChIKey: RMMJUQSANCPTMV-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (2-aminophenyl)-(4-methylphenyl)methanone |
| InChIKey | RMMJUQSANCPTMV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)