CAS 13224-79-8 appears in our catalog under these names: 4,4'–Sulfonylbis(benzene–1,2–diamine), 4,4'-Sulfonylbis(benzene-1,2-diamine), 95%, 95%, 4,4'-Sulfonylbis(benzene-1,2-diamine), 97%, 2-Amino-4-[(3,4-diaminophenyl)sulfonyl]phenylamine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-(3,4-diaminophenyl)sulfonylbenzene-1,2-diamine (CAS 13224-79-8) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 278.33 g/mol. IUPAC name: 4-(3,4-diaminophenyl)sulfonylbenzene-1,2-diamine. InChIKey: JKETWUADWJKEKN-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 4-(3,4-diaminophenyl)sulfonylbenzene-1,2-diamine |
| InChIKey | JKETWUADWJKEKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)C2=CC(=C(C=C2)N)N)N)N |
Computed by PubChem (NCBI)