CAS 1365170-20-2 is the registry number for Rel-1-((1R,3r,5S)-bicyclo[3.1.0]hexan-3-yl)-6-(methylsulfonyl)-1H-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bicyclo[3.1.0]hexanyl)-6-methylsulfonylpyrazolo[3,4-d]pyrimidine (CAS 1365170-20-2) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 278.33 g/mol. IUPAC name: 1-(3-bicyclo[3.1.0]hexanyl)-6-methylsulfonylpyrazolo[3,4-d]pyrimidine. InChIKey: VZJSTZPYFYERBO-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 1-(3-bicyclo[3.1.0]hexanyl)-6-methylsulfonylpyrazolo[3,4-d]pyrimidine |
| InChIKey | VZJSTZPYFYERBO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C2C=NN(C2=N1)C3CC4CC4C3 |
Computed by PubChem (NCBI)