CAS 77643-91-5 appears in our catalog under these names: Sulfamethazine-13C6, 98% +98%atom%13C, Sulfamethazine 13C6 (phenyl 13C6), Sulfamethazine-13C6, >95% (HPLC), Sulfamethazine–13C6, Sulfamethazine-13C6, 99.10%. Offered by: AmBeed, Dr. Ehrenstorfer, TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 1x1ml, 1x10mg.
4-amino-N-(4,6-dimethylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide (CAS 77643-91-5) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 284.29 g/mol. IUPAC name: 4-amino-N-(4,6-dimethylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide. InChIKey: ASWVTGNCAZCNNR-BULCFLCISA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 4-amino-N-(4,6-dimethylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| InChIKey | ASWVTGNCAZCNNR-BULCFLCISA-N |
| SMILES | CC1=CC(=NC(=N1)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N)C |
Computed by PubChem (NCBI)