CAS 873389-79-8 appears in our catalog under these names: 3-Amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide, 95%, 3-Amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (CAS 873389-79-8) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 278.33 g/mol. IUPAC name: 3-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide. InChIKey: GWEZRFLENUUPEQ-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 3-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| InChIKey | GWEZRFLENUUPEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NS(=O)(=O)C2=CC=CC(=C2)N)C |
Computed by PubChem (NCBI)