CAS 7228-52-6 appears in our catalog under these names: 2,2-Dimethylcycloheptanone, 95+%, 2,2-Dimethylcycloheptan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-amino-3-(5-amino-4-cyano-3-methylfuran-2-yl)-3-methyl-2H-furan-4-carbothioamide (CAS 7228-52-6) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 278.33 g/mol. IUPAC name: 5-amino-3-(5-amino-4-cyano-3-methylfuran-2-yl)-3-methyl-2H-furan-4-carbothioamide. InChIKey: OZXUALDWIWUMEQ-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 5-amino-3-(5-amino-4-cyano-3-methylfuran-2-yl)-3-methyl-2H-furan-4-carbothioamide |
| InChIKey | OZXUALDWIWUMEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=C1C#N)N)C2(COC(=C2C(=S)N)N)C |
Computed by PubChem (NCBI)