CAS 123310-03-2 appears in our catalog under these names: N-[4-(3,4-Dimethoxyphenyl)-1,3-thiazol-2-yl]guanidine, 95%, 1-(4-(3,4-Dimethoxyphenyl)thiazol-2-yl)guanidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]guanidine (CAS 123310-03-2) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 278.33 g/mol. IUPAC name: 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]guanidine. InChIKey: ZLYHAVSLJFITEK-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]guanidine |
| InChIKey | ZLYHAVSLJFITEK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)N=C(N)N)OC |
Computed by PubChem (NCBI)