cas: 31930-18-4 — see every product listed under this CAS number, including other names
2-Amino-4-nitrobenzamide, 97% (CAS 31930-18-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078258-250MG |
| cas | 31930-18-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 758.08 Pln | |
| Fluorochem | 25g | 1736.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-4-nitrobenzamide (CAS 31930-18-4) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 2-amino-4-nitrobenzamide. InChIKey: FHIFCKSBNKKCJM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-amino-4-nitrobenzamide |
| InChIKey | FHIFCKSBNKKCJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)C(=O)N |
Computed by PubChem (NCBI)