CAS 59290-38-9 appears in our catalog under these names: 4-Methyl-5-nitropicolinamide, 95%, 4–Methyl–5–nitropicolinamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-methyl-5-nitropyridine-2-carboxamide (CAS 59290-38-9) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 4-methyl-5-nitropyridine-2-carboxamide. InChIKey: MPBIFKVVEZHLCL-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-methyl-5-nitropyridine-2-carboxamide |
| InChIKey | MPBIFKVVEZHLCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)