cas: 1073371-77-3 — see every product listed under this CAS number, including other names
2-Amino-5-chlorophenylboronic Acid Pinacol Ester, 96%, 96% (CAS 1073371-77-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WBE-100mg |
| cas | 1073371-77-3 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 400.40 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 100g | 1898.00 Pln | |
| Chemat | 500g | 7473.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1073371-77-3) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: GVJZHGCVSYBPIM-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | GVJZHGCVSYBPIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)