cas: 13535-13-2 — see every product listed under this CAS number, including other names
2-Amino-5-phenylpyrazine 98+% (CAS 13535-13-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A574867-100mg |
| cas | 13535-13-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1143.56 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A574867 |
5-phenylpyrazin-2-amine (CAS 13535-13-2) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-phenylpyrazin-2-amine. InChIKey: KJAKXVBZQBPPOB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-phenylpyrazin-2-amine |
| InChIKey | KJAKXVBZQBPPOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=N2)N |
Computed by PubChem (NCBI)