2-Amino-5-phenylthiophene-3-carbonitrile, 95%
cas: 60271-29-6 — see every product listed under this CAS number, including other names
2-Amino-5-phenylthiophene-3-carbonitrile, 95% (CAS 60271-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1110350-100mg |
| cas | 60271-29-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1049.00 Pln | |
| Ambeed | 5g | 2923.56 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1030.77 Pln | |
| BLDpharm | 5g | 2863.46 Pln | |
| Fluorochem | 5g | 8099.25 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1571.60 Pln | |
| Chemat | 5g | 4446.80 Pln | |
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1143.37 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-5-phenylthiophene-3-carbonitrile (CAS 60271-29-6) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 2-amino-5-phenylthiophene-3-carbonitrile. InChIKey: WEAZGHUZIQFNLY-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2-amino-5-phenylthiophene-3-carbonitrile |
| InChIKey | WEAZGHUZIQFNLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(S2)N)C#N |
Computed by PubChem (NCBI)