2-Amino-6-fluoro-3-nitrobenzonitrile, 97%
cas: 1378862-33-9 — see every product listed under this CAS number, including other names
2-Amino-6-fluoro-3-nitrobenzonitrile, 97% (CAS 1378862-33-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A752157-100mg |
| cas | 1378862-33-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1087.94 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 475.41 Pln | |
| BLDpharm | 1g | 1164.06 Pln | |
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1226.00 Pln | |
| Chemat | 1g | 3198.80 Pln | |
| Fluorochem | 100mg | 1382.86 Pln | |
| Fluorochem | 250mg | 2273.18 Pln | |
| Fluorochem | 1g | 5933.35 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-6-fluoro-3-nitrobenzonitrile (CAS 1378862-33-9) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 2-amino-6-fluoro-3-nitrobenzonitrile. InChIKey: OLVYIQOIYHAYDU-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 2-amino-6-fluoro-3-nitrobenzonitrile |
| InChIKey | OLVYIQOIYHAYDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)C#N)F |
Computed by PubChem (NCBI)