CAS 1167056-02-1 appears in our catalog under these names: 5-Fluoro-7-nitro 1h-indazole, 95%, 5-Fluoro-7-nitro-1H-indazole 95%, 5-Fluoro-7-Nitro 1H-Indazole, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
5-fluoro-7-nitro-1H-indazole (CAS 1167056-02-1) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 5-fluoro-7-nitro-1H-indazole. InChIKey: UEKZIDSQISFLMJ-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 5-fluoro-7-nitro-1H-indazole |
| InChIKey | UEKZIDSQISFLMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)