CAS 937245-29-9 is the registry number for 2-Azido-4-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-azido-4-fluorobenzoic acid (CAS 937245-29-9) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 2-azido-4-fluorobenzoic acid. InChIKey: BTULIKFEWSZCOD-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 2-azido-4-fluorobenzoic acid |
| InChIKey | BTULIKFEWSZCOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)