Products 937245-29-9

CAS 937245-29-9 is the registry number for 2-Azido-4-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-azido-4-fluorobenzoic acid (CAS 937245-29-9) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 2-azido-4-fluorobenzoic acid. InChIKey: BTULIKFEWSZCOD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4FN3O2
Molecular weight181.12 g/mol
IUPAC name2-azido-4-fluorobenzoic acid
InChIKeyBTULIKFEWSZCOD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)N=[N+]=[N-])C(=O)O

Computed by PubChem (NCBI)