CAS 1082041-35-7 appears in our catalog under these names: 4-Fluoro-5-nitro 1h-indazole, 95%, 4-Fluoro-5-nitro 1h-indazole, 4-fluoro-5-nitro-2H-indazole. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g.
4-fluoro-5-nitro-1H-indazole (CAS 1082041-35-7) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 4-fluoro-5-nitro-1H-indazole. InChIKey: KWAYHRXXJNBMRS-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 4-fluoro-5-nitro-1H-indazole |
| InChIKey | KWAYHRXXJNBMRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)