CAS 1211586-74-1 appears in our catalog under these names: 5-Fluoro-1h-pyrazolo[3,4-b]pyridine-3-carboxylic acid, 95%, 5-Fluoro-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
5-fluoro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid (CAS 1211586-74-1) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 5-fluoro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid. InChIKey: VIPUBXOFDNKYLH-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 5-fluoro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid |
| InChIKey | VIPUBXOFDNKYLH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NNC(=C21)C(=O)O)F |
Computed by PubChem (NCBI)