Products 1190312-36-7
CAS 1190312-36-7 appears in our catalog under these names: 6-Fluoro-3-nitro-1h-pyrrolo[3,2-b]pyridine, 95%, 6-Fluoro-3-nitro-1H-pyrrolo(3,2-b)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-fluoro-3-nitro-1H-pyrrolo[3,2-b]pyridine (CAS 1190312-36-7) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 6-fluoro-3-nitro-1H-pyrrolo[3,2-b]pyridine. InChIKey: ADZBMEMTYYFHLA-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 6-fluoro-3-nitro-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | ADZBMEMTYYFHLA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC=C2[N+](=O)[O-])F |
Computed by PubChem (NCBI)