cas: 1251623-78-5 — see every product listed under this CAS number, including other names
2-Amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide 95% (CAS 1251623-78-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1077255-100mg |
| cas | 1251623-78-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 871.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1077255 |
2-amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (CAS 1251623-78-5) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: 2-amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide. InChIKey: WJQQXJCQWJBICR-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 2-amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| InChIKey | WJQQXJCQWJBICR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)NC(=O)N)N |
Computed by PubChem (NCBI)