cas: 1251623-78-5 — see every product listed under this CAS number, including other names
2-Amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide, 95%, 95% (CAS 1251623-78-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AS3G-100mg |
| cas | 1251623-78-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 798.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (CAS 1251623-78-5) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: 2-amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide. InChIKey: WJQQXJCQWJBICR-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 2-amino-N-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| InChIKey | WJQQXJCQWJBICR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)NC(=O)N)N |
Computed by PubChem (NCBI)