cas: 62119-70-4 — see every product listed under this CAS number, including other names
2-Benzofuranacetic acid, 96%, 96% (CAS 62119-70-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EG5E-50mg |
| cas | 62119-70-4 |
| size | 50mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 10g | 2464.40 Pln | |
| Chemat | 25g | 4864.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(1-benzofuran-2-yl)acetic acid (CAS 62119-70-4) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)acetic acid. InChIKey: ZYIXXVCNAOYWQA-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)acetic acid |
| InChIKey | ZYIXXVCNAOYWQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)CC(=O)O |
Computed by PubChem (NCBI)