cas: 54761-87-4 — see every product listed under this CAS number, including other names
2-Benzoyl-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one, 95% (CAS 54761-87-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F724493-250MG |
| cas | 54761-87-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 3278.03 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-benzoyl-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one (CAS 54761-87-4) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: 2-benzoyl-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one. InChIKey: XEYCCEDRIDKXEV-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 2-benzoyl-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
| InChIKey | XEYCCEDRIDKXEV-UHFFFAOYSA-N |
| SMILES | C1CN2C(CN(CC2=O)C(=O)C3=CC=CC=C3)C4=CC=CC=C41 |
Computed by PubChem (NCBI)