CAS 233276-14-7 is the registry number for Bis(4-phenyl-4,5-dihydrooxazol-2-yl)methane, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-phenyl-2-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]-4,5-dihydro-1,3-oxazole (CAS 233276-14-7) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: 4-phenyl-2-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]-4,5-dihydro-1,3-oxazole. InChIKey: IUFHJPXOLHSJTC-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 4-phenyl-2-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | IUFHJPXOLHSJTC-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)CC2=NC(CO2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)