2-Benzyl-1H-indole, 98%
cas: 3377-72-8 — see every product listed under this CAS number, including other names
2-Benzyl-1H-indole, 98% (CAS 3377-72-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1340715-250mg |
| cas | 3377-72-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 5348.81 Pln | |
| Ambeed | 1g | 13236.44 Pln | |
| Chemat | 25mg | 1691.60 Pln | |
| Chemat | 50mg | 2382.80 Pln | |
| Chemat | 100mg | 3443.60 Pln | |
| Chemat | 250mg | 5133.20 Pln | |
| BLDpharm | 25mg | 1808.28 Pln | |
| BLDpharm | 50mg | 2363.64 Pln | |
| BLDpharm | 100mg | 3518.79 Pln | |
| BLDpharm | 250mg | 5251.51 Pln | |
| BLDpharm | 1g | 12976.57 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-benzyl-1H-indole (CAS 3377-72-8) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2-benzyl-1H-indole. InChIKey: UZOBCRQUEAWJQH-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-benzyl-1H-indole |
| InChIKey | UZOBCRQUEAWJQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)