cas: 1194375-85-3 — see every product listed under this CAS number, including other names
2-Benzyl-2,6-diazaspiro[3.3]heptane dihydrochloride, 97%, 97% (CAS 1194375-85-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IRX-100mg |
| cas | 1194375-85-3 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 500mg | 1456.40 Pln | |
| Chemat | 1g | 2382.80 Pln | |
| Chemat | 5g | 6558.80 Pln | |
| Chemat | 10g | 11205.20 Pln | |
| Chemat | 25g | 18630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-benzyl-2,6-diazaspiro[3.3]heptane;dihydrochloride (CAS 1194375-85-3) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: 2-benzyl-2,6-diazaspiro[3.3]heptane;dihydrochloride. InChIKey: DCJWFGZXHGFLGJ-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 2-benzyl-2,6-diazaspiro[3.3]heptane;dihydrochloride |
| InChIKey | DCJWFGZXHGFLGJ-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)