CAS 1194375-85-3 appears in our catalog under these names: 2-Benzyl-2,6-diazaspiro[3.3]heptane, 95%, 2-Benzyl-2,6-diazaspiro(3.3)heptane dihydrochloride, 2-Benzyl-2,6-diazaspiro[3.3]heptane dihydrochloride, 97%, 97%, 2-Benzyl-2,6-diazaspiro[3.3]heptane dihydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g, 25g.
2-benzyl-2,6-diazaspiro[3.3]heptane;dihydrochloride (CAS 1194375-85-3) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: 2-benzyl-2,6-diazaspiro[3.3]heptane;dihydrochloride. InChIKey: DCJWFGZXHGFLGJ-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 2-benzyl-2,6-diazaspiro[3.3]heptane;dihydrochloride |
| InChIKey | DCJWFGZXHGFLGJ-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)