CAS 1431965-45-5 is the registry number for 3-Chloro-4-(4-methylpiperidin-1-yl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-chloro-4-(4-methylpiperidin-1-yl)aniline;hydrochloride (CAS 1431965-45-5) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: 3-chloro-4-(4-methylpiperidin-1-yl)aniline;hydrochloride. InChIKey: OJDNPYHLDCKZAU-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 3-chloro-4-(4-methylpiperidin-1-yl)aniline;hydrochloride |
| InChIKey | OJDNPYHLDCKZAU-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)N)Cl.Cl |
Computed by PubChem (NCBI)