CAS 1024010-90-9 appears in our catalog under these names: (1R,4R)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, 95%, (1R,4R)-2-Benzyl-2,5-diazabicyclo(2.2.1)heptane dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
(1R,4R)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 1024010-90-9) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: (1R,4R)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: LQADNDJRIUBIRR-MBORUXJMSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (1R,4R)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | LQADNDJRIUBIRR-MBORUXJMSA-N |
| SMILES | C1[C@@H]2CN[C@H]1CN2CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)