CAS 1217827-86-5 is the registry number for (1S,4S)-rel-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
(1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 1217827-86-5) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: LQADNDJRIUBIRR-AQEKLAMFSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | LQADNDJRIUBIRR-AQEKLAMFSA-N |
| SMILES | C1[C@H]2CN[C@@H]1CN2CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)