CAS 2454490-59-4 is the registry number for (1R,5R)-6-Benzyl-2,6-diazabicyclo[3.2.0]heptane dihydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5R)-6-benzyl-2,6-diazabicyclo[3.2.0]heptane;dihydrochloride (CAS 2454490-59-4) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: (1R,5R)-6-benzyl-2,6-diazabicyclo[3.2.0]heptane;dihydrochloride. InChIKey: QDAVXWSZRSSIOD-MBORUXJMSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (1R,5R)-6-benzyl-2,6-diazabicyclo[3.2.0]heptane;dihydrochloride |
| InChIKey | QDAVXWSZRSSIOD-MBORUXJMSA-N |
| SMILES | C1CN[C@H]2[C@@H]1N(C2)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)