cas: 2121512-80-7 — see every product listed under this CAS number, including other names
2-Benzyloxy-4,5-dimethylphenylboronic acid (CAS 2121512-80-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627680-1G |
| cas | 2121512-80-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6454.00 Pln | |
| Fluorochem | 5g | 19230.75 Pln |
| delivery time | 3-4 weeks |
|---|
(4,5-dimethyl-2-phenylmethoxyphenyl)boronic acid (CAS 2121512-80-7) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: (4,5-dimethyl-2-phenylmethoxyphenyl)boronic acid. InChIKey: ZDNNLFRTSPULKU-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | (4,5-dimethyl-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | ZDNNLFRTSPULKU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC2=CC=CC=C2)C)C)(O)O |
Computed by PubChem (NCBI)