Products 849062-20-0
CAS 849062-20-0 appears in our catalog under these names: 4-(4'-Propoxyphenyl)phenylboronic acid, 97%, 4'–n–Propoxybiphenyl–4–boronic acid (contains varying amounts of Anhydride), (4'-Propoxy-[1,1'-biphenyl]-4-yl)boronic acid 98%, 4-(4'-Propoxyphenyl)phenylboronic acid, 98%, 98%, (4'-Propoxy-[1,1'-biphenyl]-4-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
[4-(4-propoxyphenyl)phenyl]boronic acid (CAS 849062-20-0) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: [4-(4-propoxyphenyl)phenyl]boronic acid. InChIKey: ZJCHLFOLMBDUPR-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | [4-(4-propoxyphenyl)phenyl]boronic acid |
| InChIKey | ZJCHLFOLMBDUPR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4'-Propoxy-[1,1'-biphenyl]-4-yl)boronic acid, 4-(4'-Propoxyphenyl)phenylboronic acid, [4-(4-propoxyphenyl)phenyl]boronic acid, (4'-Propoxy-[1,1'-biphenyl]-4-yl)boronicacid, {4'-propoxy-[1,1'-biphenyl]-4-yl}boronic acid, 4-(4''-Propoxyphenyl)phenylboronic Acid, 4-(4'-Propoxyphenyl)phenylboronic acid, 95%, (4'-Propoxy[1,1'-biphenyl]-4-yl)boronic acid, 4'-n-Propoxybiphenyl-4-boronic acid (contains varying amounts of Anhydride)