CAS 870717-98-9 appears in our catalog under these names: 4-(4'-Isopropoxyphenyl)phenylboronic acid, 97%, (4'-Isopropoxy-[1,1'-biphenyl]-4-yl)boronic acid 97%, 4-(4'-Isopropoxyphenyl)phenylboronic acid, 97%, 97%, (4'-Isopropoxy-[1,1'-biphenyl]-4-yl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[4-(4-propan-2-yloxyphenyl)phenyl]boronic acid (CAS 870717-98-9) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: [4-(4-propan-2-yloxyphenyl)phenyl]boronic acid. InChIKey: NBOVAIFWBASNLS-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | [4-(4-propan-2-yloxyphenyl)phenyl]boronic acid |
| InChIKey | NBOVAIFWBASNLS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OC(C)C)(O)O |
Computed by PubChem (NCBI)