CAS 333788-94-6 is the registry number for 4-(Benzyloxy)-3,5-dimethylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
(3,5-dimethyl-4-phenylmethoxyphenyl)boronic acid (CAS 333788-94-6) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: (3,5-dimethyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: CJTSQFDAXDNKNQ-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | (3,5-dimethyl-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | CJTSQFDAXDNKNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)