Products 2121514-88-1

CAS 2121514-88-1 appears in our catalog under these names: (4-(Benzyloxy)-2,3-dimethylphenyl)boronic acid, 95%, (4-(Benzyloxy)-2,3-dimethylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,3-dimethyl-4-phenylmethoxyphenyl)boronic acid (CAS 2121514-88-1) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: (2,3-dimethyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: WPXMRCUTKIIJKY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17BO3
Molecular weight256.11 g/mol
IUPAC name(2,3-dimethyl-4-phenylmethoxyphenyl)boronic acid
InChIKeyWPXMRCUTKIIJKY-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OCC2=CC=CC=C2)C)C)(O)O

Computed by PubChem (NCBI)