CAS 2121514-88-1 appears in our catalog under these names: (4-(Benzyloxy)-2,3-dimethylphenyl)boronic acid, 95%, (4-(Benzyloxy)-2,3-dimethylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2,3-dimethyl-4-phenylmethoxyphenyl)boronic acid (CAS 2121514-88-1) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: (2,3-dimethyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: WPXMRCUTKIIJKY-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | (2,3-dimethyl-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | WPXMRCUTKIIJKY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC2=CC=CC=C2)C)C)(O)O |
Computed by PubChem (NCBI)